C18H27NO3 — CID 137444928
[(2S)-1-cyclohexyl-2-phenoxypropyl] (2S)-2-aminopropanoate (PubChem CID 137444928) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is [(2S)-1-cyclohexyl-2-phenoxypropyl] (2S)-2-aminopropanoate.
| Compound Name | [(2S)-1-cyclohexyl-2-phenoxypropyl] (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 137444928 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | [(2S)-1-cyclohexyl-2-phenoxypropyl] (2S)-2-aminopropanoate |
| SMILES | C[C@H](N)C(=O)OC(C1CCCCC1)[C@H](C)Oc1ccccc1 |
| InChI | InChI=1S/C18H27NO3/c1-13(19)18(20)22-17(15-9-5-3-6-10-15)14(2)21-16-11-7-4-8-12-16/h4,7-8,11-15,17H,3,5-6,9-10,19H2,1-2H3/t13-,14-,17?/m0/s1 |
| InChIKey | CWWIEBDAEUYYHM-CBVZESEGSA-N |
| XLogP | 3.29 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |