About [(1R,2S)-1-cyclopentyl-1-(3-fluorophenoxy)propan-2-yl] (2S)-2-aminopropanoate;hydrochloride
[(1R,2S)-1-cyclopentyl-1-(3-fluorophenoxy)propan-2-yl] (2S)-2-aminopropanoate;hydrochloride (PubChem CID 162329343) has the molecular formula C17H25ClFNO3
and a molecular weight of 345.84 g/mol. Its IUPAC name is [(1R,2S)-1-cyclopentyl-1-(3-fluorophenoxy)propan-2-yl] (2S)-2-aminopropanoate;hydrochloride.
Molecular Properties
| Compound Name | [(1R,2S)-1-cyclopentyl-1-(3-fluorophenoxy)propan-2-yl] (2S)-2-aminopropanoate;hydrochloride |
| PubChem CID | 162329343 |
| Molecular Formula | C17H25ClFNO3 |
| Molecular Weight | 345.84 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | [(1R,2S)-1-cyclopentyl-1-(3-fluorophenoxy)propan-2-yl] (2S)-2-aminopropanoate;hydrochloride |
| SMILES | C[C@H](N)C(=O)O[C@@H](C)[C@H](Oc1cccc(F)c1)C1CCCC1.Cl |
| InChI | InChI=1S/C17H24FNO3.ClH/c1-11(19)17(20)21-12(2)16(13-6-3-4-7-13)22-15-9-5-8-14(18)10-15;/h5,8-13,16H,3-4,6-7,19H2,1-2H3;1H/t11-,12-,16-;/m0./s1 |
| InChIKey | YFPUEBMCXBHMAU-GDZNKNMLSA-N |
| XLogP | 3.46 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R,2S)-1-cyclopentyl-1-(3-fluorophenoxy)propan-2-yl] (2S)-2-aminopropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-1-cyclopentyl-1-(3-fluorophenoxy)propan-2-yl] (2S)-2-aminopropanoate;hydrochloride?
The IUPAC name of [(1R,2S)-1-cyclopentyl-1-(3-fluorophenoxy)propan-2-yl] (2S)-2-aminopropanoate;hydrochloride (CID 162329343) is [(1R,2S)-1-cyclopentyl-1-(3-fluorophenoxy)propan-2-yl] (2S)-2-aminopropanoate;hydrochloride.
What is the SMILES notation for [(1R,2S)-1-cyclopentyl-1-(3-fluorophenoxy)propan-2-yl] (2S)-2-aminopropanoate;hydrochloride?
The canonical SMILES for [(1R,2S)-1-cyclopentyl-1-(3-fluorophenoxy)propan-2-yl] (2S)-2-aminopropanoate;hydrochloride is C[C@H](N)C(=O)O[C@@H](C)[C@H](Oc1cccc(F)c1)C1CCCC1.Cl.
What is the InChIKey of [(1R,2S)-1-cyclopentyl-1-(3-fluorophenoxy)propan-2-yl] (2S)-2-aminopropanoate;hydrochloride?
The InChIKey is YFPUEBMCXBHMAU-GDZNKNMLSA-N. The full InChI is InChI=1S/C17H24FNO3.ClH/c1-11(19)17(20)21-12(2)16(13-6-3-4-7-13)22-15-9-5-8-14(18)10-15;/h5,8-13,16H,3-4,6-7,19H2,1-2H3;1H/t11-,12-,16-;/m0./s1.
What are the key properties of [(1R,2S)-1-cyclopentyl-1-(3-fluorophenoxy)propan-2-yl] (2S)-2-aminopropanoate;hydrochloride?
[(1R,2S)-1-cyclopentyl-1-(3-fluorophenoxy)propan-2-yl] (2S)-2-aminopropanoate;hydrochloride has a molecular weight of 345.84 g/mol, XLogP of 3.46, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-1-cyclopentyl-1-(3-fluorophenoxy)propan-2-yl] (2S)-2-aminopropanoate;hydrochloride is sourced from PubChem (CID 162329343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).