About [(1R,2S)-1-(4-chloro-3-methoxyphenoxy)-1-cyclopropylpropan-2-yl] (2S)-2-aminopropanoate
[(1R,2S)-1-(4-chloro-3-methoxyphenoxy)-1-cyclopropylpropan-2-yl] (2S)-2-aminopropanoate (PubChem CID 121466207) has the molecular formula C16H22ClNO4
and a molecular weight of 327.81 g/mol. Its IUPAC name is [(1R,2S)-1-(4-chloro-3-methoxyphenoxy)-1-cyclopropylpropan-2-yl] (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | [(1R,2S)-1-(4-chloro-3-methoxyphenoxy)-1-cyclopropylpropan-2-yl] (2S)-2-aminopropanoate |
| PubChem CID | 121466207 |
| Molecular Formula | C16H22ClNO4 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | [(1R,2S)-1-(4-chloro-3-methoxyphenoxy)-1-cyclopropylpropan-2-yl] (2S)-2-aminopropanoate |
| SMILES | COc1cc(O[C@H](C2CC2)[C@H](C)OC(=O)[C@H](C)N)ccc1Cl |
| InChI | InChI=1S/C16H22ClNO4/c1-9(18)16(19)21-10(2)15(11-4-5-11)22-12-6-7-13(17)14(8-12)20-3/h6-11,15H,4-5,18H2,1-3H3/t9-,10-,15-/m0/s1 |
| InChIKey | QPJNHFVFRHMYFB-YHAQOWFVSA-N |
| XLogP | 2.78 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1R,2S)-1-(4-chloro-3-methoxyphenoxy)-1-cyclopropylpropan-2-yl] (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-1-(4-chloro-3-methoxyphenoxy)-1-cyclopropylpropan-2-yl] (2S)-2-aminopropanoate?
The IUPAC name of [(1R,2S)-1-(4-chloro-3-methoxyphenoxy)-1-cyclopropylpropan-2-yl] (2S)-2-aminopropanoate (CID 121466207) is [(1R,2S)-1-(4-chloro-3-methoxyphenoxy)-1-cyclopropylpropan-2-yl] (2S)-2-aminopropanoate.
What is the SMILES notation for [(1R,2S)-1-(4-chloro-3-methoxyphenoxy)-1-cyclopropylpropan-2-yl] (2S)-2-aminopropanoate?
The canonical SMILES for [(1R,2S)-1-(4-chloro-3-methoxyphenoxy)-1-cyclopropylpropan-2-yl] (2S)-2-aminopropanoate is COc1cc(O[C@H](C2CC2)[C@H](C)OC(=O)[C@H](C)N)ccc1Cl.
What is the InChIKey of [(1R,2S)-1-(4-chloro-3-methoxyphenoxy)-1-cyclopropylpropan-2-yl] (2S)-2-aminopropanoate?
The InChIKey is QPJNHFVFRHMYFB-YHAQOWFVSA-N. The full InChI is InChI=1S/C16H22ClNO4/c1-9(18)16(19)21-10(2)15(11-4-5-11)22-12-6-7-13(17)14(8-12)20-3/h6-11,15H,4-5,18H2,1-3H3/t9-,10-,15-/m0/s1.
What are the key properties of [(1R,2S)-1-(4-chloro-3-methoxyphenoxy)-1-cyclopropylpropan-2-yl] (2S)-2-aminopropanoate?
[(1R,2S)-1-(4-chloro-3-methoxyphenoxy)-1-cyclopropylpropan-2-yl] (2S)-2-aminopropanoate has a molecular weight of 327.81 g/mol, XLogP of 2.78, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-1-(4-chloro-3-methoxyphenoxy)-1-cyclopropylpropan-2-yl] (2S)-2-aminopropanoate is sourced from PubChem (CID 121466207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).