C16H25NO4 — CID 121462710
[(2R,3S)-3-phenoxy-1-propoxybutan-2-yl] (2S)-2-aminopropanoate (PubChem CID 121462710) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is [(2R,3S)-3-phenoxy-1-propoxybutan-2-yl] (2S)-2-aminopropanoate.
| Compound Name | [(2R,3S)-3-phenoxy-1-propoxybutan-2-yl] (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 121462710 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | [(2R,3S)-3-phenoxy-1-propoxybutan-2-yl] (2S)-2-aminopropanoate |
| SMILES | CCCOC[C@@H](OC(=O)[C@H](C)N)[C@H](C)Oc1ccccc1 |
| InChI | InChI=1S/C16H25NO4/c1-4-10-19-11-15(21-16(18)12(2)17)13(3)20-14-8-6-5-7-9-14/h5-9,12-13,15H,4,10-11,17H2,1-3H3/t12-,13-,15+/m0/s1 |
| InChIKey | ZNJJUMZSJMJYIO-KCQAQPDRSA-N |
| XLogP | 2.14 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|