C21H28F2O5 — CID 159579157
4-O-tert-butyl 1-O-[(2S,3R)-3-(2,4-difluorophenoxy)hex-5-en-2-yl] (2R)-2-methylbutanedioate (PubChem CID 159579157) has the molecular formula C21H28F2O5 and a molecular weight of 398.45 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[(2S,3R)-3-(2,4-difluorophenoxy)hex-5-en-2-yl] (2R)-2-methylbutanedioate.
| Compound Name | 4-O-tert-butyl 1-O-[(2S,3R)-3-(2,4-difluorophenoxy)hex-5-en-2-yl] (2R)-2-methylbutanedioate |
|---|---|
| PubChem CID | 159579157 |
| Molecular Formula | C21H28F2O5 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-O-tert-butyl 1-O-[(2S,3R)-3-(2,4-difluorophenoxy)hex-5-en-2-yl] (2R)-2-methylbutanedioate |
| SMILES | C=CC[C@@H](Oc1ccc(F)cc1F)[C@H](C)OC(=O)[C@H](C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H28F2O5/c1-7-8-17(27-18-10-9-15(22)12-16(18)23)14(3)26-20(25)13(2)11-19(24)28-21(4,5)6/h7,9-10,12-14,17H,1,8,11H2,2-6H3/t13-,14+,17-/m1/s1 |
| InChIKey | MIUFQFGXPWMWMY-JKIFEVAISA-N |
| XLogP | 4.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|