C24H24F6O4 — CID 160875885
1-O-[(2S)-1,1-bis(3,4,5-trifluorophenyl)propan-2-yl] 4-O-tert-butyl (2R)-2-methylbutanedioate (PubChem CID 160875885) has the molecular formula C24H24F6O4 and a molecular weight of 490.44 g/mol. Its IUPAC name is 1-O-[(2S)-1,1-bis(3,4,5-trifluorophenyl)propan-2-yl] 4-O-tert-butyl (2R)-2-methylbutanedioate.
| Compound Name | 1-O-[(2S)-1,1-bis(3,4,5-trifluorophenyl)propan-2-yl] 4-O-tert-butyl (2R)-2-methylbutanedioate |
|---|---|
| PubChem CID | 160875885 |
| Molecular Formula | C24H24F6O4 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 1-O-[(2S)-1,1-bis(3,4,5-trifluorophenyl)propan-2-yl] 4-O-tert-butyl (2R)-2-methylbutanedioate |
| SMILES | C[C@H](CC(=O)OC(C)(C)C)C(=O)O[C@@H](C)C(c1cc(F)c(F)c(F)c1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C24H24F6O4/c1-11(6-19(31)34-24(3,4)5)23(32)33-12(2)20(13-7-15(25)21(29)16(26)8-13)14-9-17(27)22(30)18(28)10-14/h7-12,20H,6H2,1-5H3/t11-,12+/m1/s1 |
| InChIKey | SMJQMKKSHCAQTE-NEPJUHHUSA-N |
| XLogP | 5.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|