C24H31NO3S — CID 71527412
tert-butyl N-[(2S,3R)-3-phenylmethoxy-1-phenylsulfanylhex-5-en-2-yl]carbamate (PubChem CID 71527412) has the molecular formula C24H31NO3S and a molecular weight of 413.58 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-phenylmethoxy-1-phenylsulfanylhex-5-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-3-phenylmethoxy-1-phenylsulfanylhex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 71527412 |
| Molecular Formula | C24H31NO3S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-phenylmethoxy-1-phenylsulfanylhex-5-en-2-yl]carbamate |
| SMILES | C=CC[C@@H](OCc1ccccc1)[C@@H](CSc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31NO3S/c1-5-12-22(27-17-19-13-8-6-9-14-19)21(25-23(26)28-24(2,3)4)18-29-20-15-10-7-11-16-20/h5-11,13-16,21-22H,1,12,17-18H2,2-4H3,(H,25,26)/t21-,22-/m1/s1 |
| InChIKey | KYHGRDVUHIHCKU-FGZHOGPDSA-N |
| XLogP | 5.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|