C22H27NO4S — CID 23446086
2-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylsulfanylbutanoic acid (PubChem CID 23446086) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylsulfanylbutanoic acid.
| Compound Name | 2-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 23446086 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 2-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylsulfanylbutanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CSc1ccccc1)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H27NO4S/c1-22(2,3)27-21(26)23-19(15-28-17-12-8-5-9-13-17)18(20(24)25)14-16-10-6-4-7-11-16/h4-13,18-19H,14-15H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | JQVROAFUUZFQMR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |