C23H29NO4 — CID 11234457
benzyl N-[(4S,5S)-8-hydroxy-5-phenylmethoxyoct-1-en-4-yl]carbamate (PubChem CID 11234457) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is benzyl N-[(4S,5S)-8-hydroxy-5-phenylmethoxyoct-1-en-4-yl]carbamate.
| Compound Name | benzyl N-[(4S,5S)-8-hydroxy-5-phenylmethoxyoct-1-en-4-yl]carbamate |
|---|---|
| PubChem CID | 11234457 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | benzyl N-[(4S,5S)-8-hydroxy-5-phenylmethoxyoct-1-en-4-yl]carbamate |
| SMILES | C=CC[C@H](NC(=O)OCc1ccccc1)[C@H](CCCO)OCc1ccccc1 |
| InChI | InChI=1S/C23H29NO4/c1-2-10-21(24-23(26)28-18-20-13-7-4-8-14-20)22(15-9-16-25)27-17-19-11-5-3-6-12-19/h2-8,11-14,21-22,25H,1,9-10,15-18H2,(H,24,26)/t21-,22-/m0/s1 |
| InChIKey | SDUVDYFURLNURE-VXKWHMMOSA-N |
| XLogP | 4.22 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|