C15H17NO6 — CID 10638414
(2S,3R)-2-(phenylmethoxycarbonylamino)-3-prop-2-enylbutanedioic acid (PubChem CID 10638414) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is (2S,3R)-2-(phenylmethoxycarbonylamino)-3-prop-2-enylbutanedioic acid.
| Compound Name | (2S,3R)-2-(phenylmethoxycarbonylamino)-3-prop-2-enylbutanedioic acid |
|---|---|
| PubChem CID | 10638414 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (2S,3R)-2-(phenylmethoxycarbonylamino)-3-prop-2-enylbutanedioic acid |
| SMILES | C=CC[C@@H](C(=O)O)[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H17NO6/c1-2-6-11(13(17)18)12(14(19)20)16-15(21)22-9-10-7-4-3-5-8-10/h2-5,7-8,11-12H,1,6,9H2,(H,16,21)(H,17,18)(H,19,20)/t11-,12+/m1/s1 |
| InChIKey | MRDHIMMUNUDOPV-NEPJUHHUSA-N |
| XLogP | 1.64 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|