C22H29NO6 — CID 59932699
1-O-benzyl 4-O-prop-2-enyl (2S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enylbutanedioate (PubChem CID 59932699) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is 1-O-benzyl 4-O-prop-2-enyl (2S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enylbutanedioate.
| Compound Name | 1-O-benzyl 4-O-prop-2-enyl (2S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enylbutanedioate |
|---|---|
| PubChem CID | 59932699 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 1-O-benzyl 4-O-prop-2-enyl (2S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enylbutanedioate |
| SMILES | C=CCOC(=O)C(NC(=O)OC(C)(C)C)[C@H](CC=C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H29NO6/c1-6-11-17(19(24)28-15-16-12-9-8-10-13-16)18(20(25)27-14-7-2)23-21(26)29-22(3,4)5/h6-10,12-13,17-18H,1-2,11,14-15H2,3-5H3,(H,23,26)/t17-,18?/m0/s1 |
| InChIKey | QGDONZOHDBFHDO-ZENAZSQFSA-N |
| XLogP | 3.54 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|