C18H25NO5S — CID 174779917
benzyl 3-formyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate (PubChem CID 174779917) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is benzyl 3-formyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate.
| Compound Name | benzyl 3-formyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 174779917 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | benzyl 3-formyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCC(C=O)C(NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H25NO5S/c1-18(2,3)24-17(22)19-15(14(10-20)12-25-4)16(21)23-11-13-8-6-5-7-9-13/h5-10,14-15H,11-12H2,1-4H3,(H,19,22) |
| InChIKey | CXTMSSFVBFZYEY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|