C15H20NO4Zn- — CID 59740969
benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;zinc (PubChem CID 59740969) has the molecular formula C15H20NO4Zn- and a molecular weight of 343.72 g/mol. Its IUPAC name is benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;zinc.
| Compound Name | benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;zinc |
|---|---|
| PubChem CID | 59740969 |
| Molecular Formula | C15H20NO4Zn- |
| Molecular Weight | 343.72 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;zinc |
| SMILES | [CH2-]C(NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1.[Zn] |
| InChI | InChI=1S/C15H20NO4.Zn/c1-11(16-14(18)20-15(2,3)4)13(17)19-10-12-8-6-5-7-9-12;/h5-9,11H,1,10H2,2-4H3,(H,16,18);/q-1; |
| InChIKey | ZGDCNIMEYOCXMM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.72 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|