C27H33NO6 — CID 67061831
dibenzyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-prop-2-enylpentanedioate (PubChem CID 67061831) has the molecular formula C27H33NO6 and a molecular weight of 467.56 g/mol. Its IUPAC name is dibenzyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-prop-2-enylpentanedioate.
| Compound Name | dibenzyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-prop-2-enylpentanedioate |
|---|---|
| PubChem CID | 67061831 |
| Molecular Formula | C27H33NO6 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | dibenzyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-prop-2-enylpentanedioate |
| SMILES | C=CCC(C[C@@H](NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H33NO6/c1-5-12-22(24(29)32-18-20-13-8-6-9-14-20)17-23(28-26(31)34-27(2,3)4)25(30)33-19-21-15-10-7-11-16-21/h5-11,13-16,22-23H,1,12,17-19H2,2-4H3,(H,28,31)/t22?,23-/m1/s1 |
| InChIKey | ORNXGISJPWULCB-OZAIVSQSSA-N |
| XLogP | 4.95 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|