C19H26ClNO4 — CID 10474162
benzyl (2S)-4-(chloromethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate (PubChem CID 10474162) has the molecular formula C19H26ClNO4 and a molecular weight of 367.87 g/mol. Its IUPAC name is benzyl (2S)-4-(chloromethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate.
| Compound Name | benzyl (2S)-4-(chloromethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate |
|---|---|
| PubChem CID | 10474162 |
| Molecular Formula | C19H26ClNO4 |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | benzyl (2S)-4-(chloromethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate |
| SMILES | C=CC(CCl)C[C@H](NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H26ClNO4/c1-5-14(12-20)11-16(21-18(23)25-19(2,3)4)17(22)24-13-15-9-7-6-8-10-15/h5-10,14,16H,1,11-13H2,2-4H3,(H,21,23)/t14?,16-/m0/s1 |
| InChIKey | ZRCMXPKKZQVAJQ-WMCAAGNKSA-N |
| XLogP | 4.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|