C26H33NO7 — CID 90340953
5-O-benzyl 1-O-methyl (2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxymethyl)pentanedioate (PubChem CID 90340953) has the molecular formula C26H33NO7 and a molecular weight of 471.55 g/mol. Its IUPAC name is 5-O-benzyl 1-O-methyl (2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxymethyl)pentanedioate.
| Compound Name | 5-O-benzyl 1-O-methyl (2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxymethyl)pentanedioate |
|---|---|
| PubChem CID | 90340953 |
| Molecular Formula | C26H33NO7 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 5-O-benzyl 1-O-methyl (2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxymethyl)pentanedioate |
| SMILES | COC(=O)[C@@H](COCc1ccccc1)C[C@H](NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H33NO7/c1-26(2,3)34-25(30)27-22(24(29)33-17-20-13-9-6-10-14-20)15-21(23(28)31-4)18-32-16-19-11-7-5-8-12-19/h5-14,21-22H,15-18H2,1-4H3,(H,27,30)/t21-,22+/m1/s1 |
| InChIKey | REFZNPNKUZLIQP-YADHBBJMSA-N |
| XLogP | 4.02 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|