C15H25NO6 — CID 88989959
dimethyl (4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-prop-2-enylpentanedioate (PubChem CID 88989959) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is dimethyl (4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-prop-2-enylpentanedioate.
| Compound Name | dimethyl (4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-prop-2-enylpentanedioate |
|---|---|
| PubChem CID | 88989959 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | dimethyl (4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-prop-2-enylpentanedioate |
| SMILES | C=CC[C@@H](CC(NC(=O)OC(C)(C)C)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C15H25NO6/c1-7-8-10(12(17)20-5)9-11(13(18)21-6)16-14(19)22-15(2,3)4/h7,10-11H,1,8-9H2,2-6H3,(H,16,19)/t10-,11?/m0/s1 |
| InChIKey | OLYQRWOTCNSPDX-VUWPPUDQSA-N |
| XLogP | 1.81 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|