C19H35NO6Si — CID 10982278
1-O-methyl 5-O-(2-trimethylsilylethyl) (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enylpentanedioate (PubChem CID 10982278) has the molecular formula C19H35NO6Si and a molecular weight of 401.58 g/mol. Its IUPAC name is 1-O-methyl 5-O-(2-trimethylsilylethyl) (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enylpentanedioate.
| Compound Name | 1-O-methyl 5-O-(2-trimethylsilylethyl) (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enylpentanedioate |
|---|---|
| PubChem CID | 10982278 |
| Molecular Formula | C19H35NO6Si |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 1-O-methyl 5-O-(2-trimethylsilylethyl) (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enylpentanedioate |
| SMILES | C=CC[C@@H](C[C@H](NC(=O)OC(C)(C)C)C(=O)OCC[Si](C)(C)C)C(=O)OC |
| InChI | InChI=1S/C19H35NO6Si/c1-9-10-14(16(21)24-5)13-15(20-18(23)26-19(2,3)4)17(22)25-11-12-27(6,7)8/h9,14-15H,1,10-13H2,2-8H3,(H,20,23)/t14-,15-/m0/s1 |
| InChIKey | BFHIYHKDHKPLPC-GJZGRUSLSA-N |
| XLogP | 3.52 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|