C13H27NO4Si — CID 174938444
2-trimethylsilylethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 174938444) has the molecular formula C13H27NO4Si and a molecular weight of 289.45 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | 2-trimethylsilylethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 174938444 |
| Molecular Formula | C13H27NO4Si |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C13H27NO4Si/c1-10(14-12(16)18-13(2,3)4)11(15)17-8-9-19(5,6)7/h10H,8-9H2,1-7H3,(H,14,16) |
| InChIKey | TXWIZFFMEIIRLT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|