C19H39NO6Si2 — CID 162728324
bis(2-trimethylsilylethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 162728324) has the molecular formula C19H39NO6Si2 and a molecular weight of 433.69 g/mol. Its IUPAC name is bis(2-trimethylsilylethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
| Compound Name | bis(2-trimethylsilylethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| PubChem CID | 162728324 |
| Molecular Formula | C19H39NO6Si2 |
| Molecular Weight | 433.69 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | bis(2-trimethylsilylethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OCC[Si](C)(C)C)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C19H39NO6Si2/c1-19(2,3)26-18(23)20-15(17(22)25-11-13-28(7,8)9)14-16(21)24-10-12-27(4,5)6/h15H,10-14H2,1-9H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | VWSHHNOJFMNAOM-HNNXBMFYSA-N |
| XLogP | 4.03 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.69 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|