C18H34FN2O6+ — CID 174201225
fluoromethyl-dimethyl-[2-[4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]oxyethyl]azanium (PubChem CID 174201225) has the molecular formula C18H34FN2O6+ and a molecular weight of 393.48 g/mol. Its IUPAC name is fluoromethyl-dimethyl-[2-[4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]oxyethyl]azanium.
| Compound Name | fluoromethyl-dimethyl-[2-[4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 174201225 |
| Molecular Formula | C18H34FN2O6+ |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | fluoromethyl-dimethyl-[2-[4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]oxyethyl]azanium |
| SMILES | CC(C)(C)OC(=O)CC(NC(=O)OC(C)(C)C)C(=O)OCC[N+](C)(C)CF |
| InChI | InChI=1S/C18H33FN2O6/c1-17(2,3)26-14(22)11-13(20-16(24)27-18(4,5)6)15(23)25-10-9-21(7,8)12-19/h13H,9-12H2,1-8H3/p+1 |
| InChIKey | IJARDYZGDFIIBP-UHFFFAOYSA-O |
| XLogP | 2.16 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|