C11H18ClNO5 — CID 165439278
chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate (PubChem CID 165439278) has the molecular formula C11H18ClNO5 and a molecular weight of 279.72 g/mol. Its IUPAC name is chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate.
| Compound Name | chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate |
|---|---|
| PubChem CID | 165439278 |
| Molecular Formula | C11H18ClNO5 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate |
| SMILES | CC(=O)CC(NC(=O)OC(C)(C)C)C(=O)OCCl |
| InChI | InChI=1S/C11H18ClNO5/c1-7(14)5-8(9(15)17-6-12)13-10(16)18-11(2,3)4/h8H,5-6H2,1-4H3,(H,13,16) |
| InChIKey | HIGVSRXYQSHXLI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|