C11H20ClNO6S — CID 165439209
chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoate (PubChem CID 165439209) has the molecular formula C11H20ClNO6S and a molecular weight of 329.80 g/mol. Its IUPAC name is chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoate.
| Compound Name | chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 165439209 |
| Molecular Formula | C11H20ClNO6S |
| Molecular Weight | 329.80 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoate |
| SMILES | CC(C)(C)OC(=O)NC(CCS(C)(=O)=O)C(=O)OCCl |
| InChI | InChI=1S/C11H20ClNO6S/c1-11(2,3)19-10(15)13-8(9(14)18-7-12)5-6-20(4,16)17/h8H,5-7H2,1-4H3,(H,13,15) |
| InChIKey | NEIRSDYNTALERR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.80 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|