C13H23NO6S — CID 10567784
methyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-methylsulfonylhex-2-enoate (PubChem CID 10567784) has the molecular formula C13H23NO6S and a molecular weight of 321.40 g/mol. Its IUPAC name is methyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-methylsulfonylhex-2-enoate.
| Compound Name | methyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-methylsulfonylhex-2-enoate |
|---|---|
| PubChem CID | 10567784 |
| Molecular Formula | C13H23NO6S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | methyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-methylsulfonylhex-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](CCS(C)(=O)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO6S/c1-13(2,3)20-12(16)14-10(6-7-11(15)19-4)8-9-21(5,17)18/h6-7,10H,8-9H2,1-5H3,(H,14,16)/b7-6+/t10-/m1/s1 |
| InChIKey | IMGVYDDWHHLGBC-VQCYPWCPSA-N |
| XLogP | 1.04 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|