C11H19NO4 — CID 10857231
methyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate (PubChem CID 10857231) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is methyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate.
| Compound Name | methyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate |
|---|---|
| PubChem CID | 10857231 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | methyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19NO4/c1-8(6-7-9(13)15-5)12-10(14)16-11(2,3)4/h6-8H,1-5H3,(H,12,14)/b7-6+/t8-/m0/s1 |
| InChIKey | JRSYYLJDKVSNJH-CZEYKFRCSA-N |
| XLogP | 1.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|