C15H25N3O6 — CID 88950844
methyl (E)-4-[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethylamino]-4-oxobut-2-enoate (PubChem CID 88950844) has the molecular formula C15H25N3O6 and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl (E)-4-[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethylamino]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 88950844 |
| Molecular Formula | C15H25N3O6 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | methyl (E)-4-[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethylamino]-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)NCCNC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25N3O6/c1-10(18-14(22)24-15(2,3)4)13(21)17-9-8-16-11(19)6-7-12(20)23-5/h6-7,10H,8-9H2,1-5H3,(H,16,19)(H,17,21)(H,18,22)/b7-6+/t10-/m0/s1 |
| InChIKey | PFZBEOXHHUYJMG-FGEFZZPRSA-N |
| XLogP | -0.14 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|