C10H20N2O4 — CID 134128297
tert-butyl N-[2-[[(2R)-2-hydroxypropanoyl]amino]ethyl]carbamate (PubChem CID 134128297) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2R)-2-hydroxypropanoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2R)-2-hydroxypropanoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 134128297 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | tert-butyl N-[2-[[(2R)-2-hydroxypropanoyl]amino]ethyl]carbamate |
| SMILES | C[C@@H](O)C(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H20N2O4/c1-7(13)8(14)11-5-6-12-9(15)16-10(2,3)4/h7,13H,5-6H2,1-4H3,(H,11,14)(H,12,15)/t7-/m1/s1 |
| InChIKey | AIGCCQAHPBFJQP-SSDOTTSWSA-N |
| XLogP | 0.01 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|