C14H30N2O2 — CID 102610042
tert-butyl N-[2-(2,2,3-trimethylbutylamino)ethyl]carbamate (PubChem CID 102610042) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is tert-butyl N-[2-(2,2,3-trimethylbutylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2,2,3-trimethylbutylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 102610042 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | tert-butyl N-[2-(2,2,3-trimethylbutylamino)ethyl]carbamate |
| SMILES | CC(C)C(C)(C)CNCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H30N2O2/c1-11(2)14(6,7)10-15-8-9-16-12(17)18-13(3,4)5/h11,15H,8-10H2,1-7H3,(H,16,17) |
| InChIKey | PESVCRULBNOPMY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|