C13H24N2O5 — CID 118210622
[2-methyl-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-oxopropan-2-yl] acetate (PubChem CID 118210622) has the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. Its IUPAC name is [2-methyl-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-oxopropan-2-yl] acetate.
| Compound Name | [2-methyl-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-oxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 118210622 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | [2-methyl-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-oxopropan-2-yl] acetate |
| SMILES | CC(=O)OC(C)(C=O)CNCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24N2O5/c1-10(17)19-13(5,9-16)8-14-6-7-15-11(18)20-12(2,3)4/h9,14H,6-8H2,1-5H3,(H,15,18) |
| InChIKey | RXTUYXQDQZTIPO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|