C10H21N3O3 — CID 78978111
tert-butyl N-[2-(dimethylcarbamoylamino)ethyl]carbamate (PubChem CID 78978111) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is tert-butyl N-[2-(dimethylcarbamoylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(dimethylcarbamoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 78978111 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | tert-butyl N-[2-(dimethylcarbamoylamino)ethyl]carbamate |
| SMILES | CN(C)C(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H21N3O3/c1-10(2,3)16-9(15)12-7-6-11-8(14)13(4)5/h6-7H2,1-5H3,(H,11,14)(H,12,15) |
| InChIKey | JTHLDFXXYMYOFU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|