C11H23N3O4 — CID 108864477
tert-butyl N-[2-[[2-hydroxyethyl(methyl)carbamoyl]amino]ethyl]carbamate (PubChem CID 108864477) has the molecular formula C11H23N3O4 and a molecular weight of 261.32 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-hydroxyethyl(methyl)carbamoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-hydroxyethyl(methyl)carbamoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108864477 |
| Molecular Formula | C11H23N3O4 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | tert-butyl N-[2-[[2-hydroxyethyl(methyl)carbamoyl]amino]ethyl]carbamate |
| SMILES | CN(CCO)C(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H23N3O4/c1-11(2,3)18-10(17)13-6-5-12-9(16)14(4)7-8-15/h15H,5-8H2,1-4H3,(H,12,16)(H,13,17) |
| InChIKey | HFRJGMAUBDRYPB-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|