C12H25NO3 — CID 86028262
tert-butyl N-(5-hydroxy-3,3-dimethylpentyl)carbamate (PubChem CID 86028262) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is tert-butyl N-(5-hydroxy-3,3-dimethylpentyl)carbamate.
| Compound Name | tert-butyl N-(5-hydroxy-3,3-dimethylpentyl)carbamate |
|---|---|
| PubChem CID | 86028262 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | tert-butyl N-(5-hydroxy-3,3-dimethylpentyl)carbamate |
| SMILES | CC(C)(CCO)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H25NO3/c1-11(2,3)16-10(15)13-8-6-12(4,5)7-9-14/h14H,6-9H2,1-5H3,(H,13,15) |
| InChIKey | OQUWIJGPNVGEDU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |