C17H33NO8 — CID 161081619
tert-butyl N-(2-hydroxyethyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate (PubChem CID 161081619) has the molecular formula C17H33NO8 and a molecular weight of 379.45 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxyethyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate.
| Compound Name | tert-butyl N-(2-hydroxyethyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
|---|---|
| PubChem CID | 161081619 |
| Molecular Formula | C17H33NO8 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | tert-butyl N-(2-hydroxyethyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
| SMILES | CC(C)(C)OC(=O)NCCO.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H18O5.C7H15NO3/c1-9(2,3)14-7(11)13-8(12)15-10(4,5)6;1-7(2,3)11-6(10)8-4-5-9/h1-6H3;9H,4-5H2,1-3H3,(H,8,10) |
| InChIKey | UFZGYAWRKIWVBE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|