C18H31NO7 — CID 161111574
tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl N-prop-2-ynylcarbamate (PubChem CID 161111574) has the molecular formula C18H31NO7 and a molecular weight of 373.45 g/mol. Its IUPAC name is tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl N-prop-2-ynylcarbamate.
| Compound Name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl N-prop-2-ynylcarbamate |
|---|---|
| PubChem CID | 161111574 |
| Molecular Formula | C18H31NO7 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl N-prop-2-ynylcarbamate |
| SMILES | C#CCNC(=O)OC(C)(C)C.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H18O5.C8H13NO2/c1-9(2,3)14-7(11)13-8(12)15-10(4,5)6;1-5-6-9-7(10)11-8(2,3)4/h1-6H3;1H,6H2,2-4H3,(H,9,10) |
| InChIKey | UJTKCQMOXNCRSD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|