C21H39NO9 — CID 158817898
tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;(2S)-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid (PubChem CID 158817898) has the molecular formula C21H39NO9 and a molecular weight of 449.54 g/mol. Its IUPAC name is tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;(2S)-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid.
| Compound Name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;(2S)-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 158817898 |
| Molecular Formula | C21H39NO9 |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;(2S)-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid |
| SMILES | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(C)[C@@H](CNC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C11H21NO4.C10H18O5/c1-7(2)8(9(13)14)6-12-10(15)16-11(3,4)5;1-9(2,3)14-7(11)13-8(12)15-10(4,5)6/h7-8H,6H2,1-5H3,(H,12,15)(H,13,14);1-6H3/t8-;/m1./s1 |
| InChIKey | IVMPGWLRDOFVHB-DDWIOCJRSA-N |
| XLogP | 4.74 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|