C10H17NO7 — CID 119053739
2-hydroxy-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanedioic acid (PubChem CID 119053739) has the molecular formula C10H17NO7 and a molecular weight of 263.25 g/mol. Its IUPAC name is 2-hydroxy-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanedioic acid.
| Compound Name | 2-hydroxy-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanedioic acid |
|---|---|
| PubChem CID | 119053739 |
| Molecular Formula | C10H17NO7 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-hydroxy-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanedioic acid |
| SMILES | CC(C)(C)OC(=O)NCC(C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C10H17NO7/c1-10(2,3)18-9(17)11-4-5(7(13)14)6(12)8(15)16/h5-6,12H,4H2,1-3H3,(H,11,17)(H,13,14)(H,15,16) |
| InChIKey | CTQDGDKIFCGDIC-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |