C11H20NO4- — CID 51777226
(2R)-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoate (PubChem CID 51777226) has the molecular formula C11H20NO4- and a molecular weight of 230.28 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoate.
| Compound Name | (2R)-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoate |
|---|---|
| PubChem CID | 51777226 |
| Molecular Formula | C11H20NO4- |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (2R)-3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoate |
| SMILES | CC(C)[C@H](CNC(=O)OC(C)(C)C)C(=O)[O-] |
| InChI | InChI=1S/C11H21NO4/c1-7(2)8(9(13)14)6-12-10(15)16-11(3,4)5/h7-8H,6H2,1-5H3,(H,12,15)(H,13,14)/p-1/t8-/m0/s1 |
| InChIKey | IGJIQZVMCRTQQX-QMMMGPOBSA-M |
| XLogP | 0.53 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |