C11H21NO3 — CID 98041193
tert-butyl N-[(2R)-2-formyl-3-methylbutyl]carbamate (PubChem CID 98041193) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-formyl-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-formyl-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 98041193 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | tert-butyl N-[(2R)-2-formyl-3-methylbutyl]carbamate |
| SMILES | CC(C)[C@@H](C=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO3/c1-8(2)9(7-13)6-12-10(14)15-11(3,4)5/h7-9H,6H2,1-5H3,(H,12,14)/t9-/m1/s1 |
| InChIKey | FCTUHRCTKMXYGY-SECBINFHSA-N |
| XLogP | 1.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|