C10H21NO5 — CID 142468263
tert-butyl N-(2-hydroxy-3-oxopropyl)carbamate;methoxymethane (PubChem CID 142468263) has the molecular formula C10H21NO5 and a molecular weight of 235.28 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxy-3-oxopropyl)carbamate;methoxymethane.
| Compound Name | tert-butyl N-(2-hydroxy-3-oxopropyl)carbamate;methoxymethane |
|---|---|
| PubChem CID | 142468263 |
| Molecular Formula | C10H21NO5 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | tert-butyl N-(2-hydroxy-3-oxopropyl)carbamate;methoxymethane |
| SMILES | CC(C)(C)OC(=O)NCC(O)C=O.COC |
| InChI | InChI=1S/C8H15NO4.C2H6O/c1-8(2,3)13-7(12)9-4-6(11)5-10;1-3-2/h5-6,11H,4H2,1-3H3,(H,9,12);1-2H3 |
| InChIKey | SLNOGEAKXOQHKM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|