About tert-butyl N-(4-aminobut-2-ynyl)carbamate;hydrochloride
tert-butyl N-(4-aminobut-2-ynyl)carbamate;hydrochloride (PubChem CID 178189908) has the molecular formula C9H17ClN2O2
and a molecular weight of 220.70 g/mol. Its IUPAC name is tert-butyl N-(4-aminobut-2-ynyl)carbamate;hydrochloride.
Molecular Properties
| Compound Name | tert-butyl N-(4-aminobut-2-ynyl)carbamate;hydrochloride |
| PubChem CID | 178189908 |
| Molecular Formula | C9H17ClN2O2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | tert-butyl N-(4-aminobut-2-ynyl)carbamate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)NCC#CCN.Cl |
| InChI | InChI=1S/C9H16N2O2.ClH/c1-9(2,3)13-8(12)11-7-5-4-6-10;/h6-7,10H2,1-3H3,(H,11,12);1H |
| InChIKey | YGBPVWUMUYSDSP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(4-aminobut-2-ynyl)carbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(4-aminobut-2-ynyl)carbamate;hydrochloride?
The IUPAC name of tert-butyl N-(4-aminobut-2-ynyl)carbamate;hydrochloride (CID 178189908) is tert-butyl N-(4-aminobut-2-ynyl)carbamate;hydrochloride.
What is the SMILES notation for tert-butyl N-(4-aminobut-2-ynyl)carbamate;hydrochloride?
The canonical SMILES for tert-butyl N-(4-aminobut-2-ynyl)carbamate;hydrochloride is CC(C)(C)OC(=O)NCC#CCN.Cl.
What is the InChIKey of tert-butyl N-(4-aminobut-2-ynyl)carbamate;hydrochloride?
The InChIKey is YGBPVWUMUYSDSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2.ClH/c1-9(2,3)13-8(12)11-7-5-4-6-10;/h6-7,10H2,1-3H3,(H,11,12);1H.
What are the key properties of tert-butyl N-(4-aminobut-2-ynyl)carbamate;hydrochloride?
tert-butyl N-(4-aminobut-2-ynyl)carbamate;hydrochloride has a molecular weight of 220.70 g/mol, XLogP of 0.89, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(4-aminobut-2-ynyl)carbamate;hydrochloride is sourced from PubChem (CID 178189908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).