C14H18N2O2 — CID 15431121
tert-butyl N-[3-(2-aminophenyl)prop-2-ynyl]carbamate (PubChem CID 15431121) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is tert-butyl N-[3-(2-aminophenyl)prop-2-ynyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-aminophenyl)prop-2-ynyl]carbamate |
|---|---|
| PubChem CID | 15431121 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | tert-butyl N-[3-(2-aminophenyl)prop-2-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC#Cc1ccccc1N |
| InChI | InChI=1S/C14H18N2O2/c1-14(2,3)18-13(17)16-10-6-8-11-7-4-5-9-12(11)15/h4-5,7,9H,10,15H2,1-3H3,(H,16,17) |
| InChIKey | HQVBHCGNRWJWCO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|