C21H34N2O3Si — CID 168938504
tert-butyl N-[3-[4-amino-2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]prop-2-ynyl]carbamate (PubChem CID 168938504) has the molecular formula C21H34N2O3Si and a molecular weight of 390.60 g/mol. Its IUPAC name is tert-butyl N-[3-[4-amino-2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]prop-2-ynyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-amino-2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]prop-2-ynyl]carbamate |
|---|---|
| PubChem CID | 168938504 |
| Molecular Formula | C21H34N2O3Si |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | tert-butyl N-[3-[4-amino-2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]prop-2-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC#Cc1ccc(N)cc1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34N2O3Si/c1-20(2,3)26-19(24)23-13-9-10-16-11-12-18(22)14-17(16)15-25-27(7,8)21(4,5)6/h11-12,14H,13,15,22H2,1-8H3,(H,23,24) |
| InChIKey | ASHHBNIUFXYODJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|