C20H38N2O3SiSn — CID 163399095
tert-butyl N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-trimethylstannyl-2-pyridinyl]carbamate (PubChem CID 163399095) has the molecular formula C20H38N2O3SiSn and a molecular weight of 501.33 g/mol. Its IUPAC name is tert-butyl N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-trimethylstannyl-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-trimethylstannyl-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 163399095 |
| Molecular Formula | C20H38N2O3SiSn |
| Molecular Weight | 501.33 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | tert-butyl N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-trimethylstannyl-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc([Sn](C)(C)C)ccc1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H29N2O3Si.3CH3.Sn/c1-16(2,3)22-15(20)19-14-13(10-9-11-18-14)12-21-23(7,8)17(4,5)6;;;;/h9-10H,12H2,1-8H3,(H,18,19,20);3*1H3; |
| InChIKey | FLUZEOBJKQPABJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.33 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|