C16H26ClNO3Si — CID 67148148
methyl N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]carbamate (PubChem CID 67148148) has the molecular formula C16H26ClNO3Si and a molecular weight of 343.93 g/mol. Its IUPAC name is methyl N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]carbamate.
| Compound Name | methyl N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]carbamate |
|---|---|
| PubChem CID | 67148148 |
| Molecular Formula | C16H26ClNO3Si |
| Molecular Weight | 343.93 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | methyl N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]carbamate |
| SMILES | COC(=O)NCc1ccc(Cl)c(CO[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H26ClNO3Si/c1-16(2,3)22(5,6)21-11-13-9-12(7-8-14(13)17)10-18-15(19)20-4/h7-9H,10-11H2,1-6H3,(H,18,19) |
| InChIKey | CTXSMVROYGHXPB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.93 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|