C13H20Cl2OSi — CID 91737025
tert-butyl-[(2,4-dichlorophenyl)methoxy]-dimethylsilane (PubChem CID 91737025) has the molecular formula C13H20Cl2OSi and a molecular weight of 291.29 g/mol. Its IUPAC name is tert-butyl-[(2,4-dichlorophenyl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2,4-dichlorophenyl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 91737025 |
| Molecular Formula | C13H20Cl2OSi |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | tert-butyl-[(2,4-dichlorophenyl)methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H20Cl2OSi/c1-13(2,3)17(4,5)16-9-10-6-7-11(14)8-12(10)15/h6-8H,9H2,1-5H3 |
| InChIKey | VVUZESYLAMVCMN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|