C10H12Cl2O — CID 527851
2,4-dichloro-1-(propoxymethyl)benzene (PubChem CID 527851) has the molecular formula C10H12Cl2O and a molecular weight of 219.11 g/mol. Its IUPAC name is 2,4-dichloro-1-(propoxymethyl)benzene.
| Compound Name | 2,4-dichloro-1-(propoxymethyl)benzene |
|---|---|
| PubChem CID | 527851 |
| Molecular Formula | C10H12Cl2O |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 2,4-dichloro-1-(propoxymethyl)benzene |
| SMILES | CCCOCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2O/c1-2-5-13-7-8-3-4-9(11)6-10(8)12/h3-4,6H,2,5,7H2,1H3 |
| InChIKey | FZFOGSLKWQTCIQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|