C9H11Cl2NO — CID 14821323
2-[(2,4-dichlorophenyl)methoxy]ethanamine (PubChem CID 14821323) has the molecular formula C9H11Cl2NO and a molecular weight of 220.10 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methoxy]ethanamine.
| Compound Name | 2-[(2,4-dichlorophenyl)methoxy]ethanamine |
|---|---|
| PubChem CID | 14821323 |
| Molecular Formula | C9H11Cl2NO |
| Molecular Weight | 220.10 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methoxy]ethanamine |
| SMILES | NCCOCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H11Cl2NO/c10-8-2-1-7(9(11)5-8)6-13-4-3-12/h1-2,5H,3-4,6,12H2 |
| InChIKey | MRFKDXYLAQBCGD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.10 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|