C10H12Cl3NO2S — CID 162663453
2-aminoethyl (2,4-dichlorophenyl)methylsulfanylformate;hydrochloride (PubChem CID 162663453) has the molecular formula C10H12Cl3NO2S and a molecular weight of 316.64 g/mol. Its IUPAC name is 2-aminoethyl (2,4-dichlorophenyl)methylsulfanylformate;hydrochloride.
| Compound Name | 2-aminoethyl (2,4-dichlorophenyl)methylsulfanylformate;hydrochloride |
|---|---|
| PubChem CID | 162663453 |
| Molecular Formula | C10H12Cl3NO2S |
| Molecular Weight | 316.64 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | 2-aminoethyl (2,4-dichlorophenyl)methylsulfanylformate;hydrochloride |
| SMILES | Cl.NCCOC(=O)SCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl2NO2S.ClH/c11-8-2-1-7(9(12)5-8)6-16-10(14)15-4-3-13;/h1-2,5H,3-4,6,13H2;1H |
| InChIKey | DFOAXBFQZWDHJN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|