C14H10Cl2O2S2 — CID 177407153
(2,4-dichlorophenyl)methylsulfanyl-(4-hydroxyphenyl)sulfanylmethanone (PubChem CID 177407153) has the molecular formula C14H10Cl2O2S2 and a molecular weight of 345.27 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methylsulfanyl-(4-hydroxyphenyl)sulfanylmethanone.
| Compound Name | (2,4-dichlorophenyl)methylsulfanyl-(4-hydroxyphenyl)sulfanylmethanone |
|---|---|
| PubChem CID | 177407153 |
| Molecular Formula | C14H10Cl2O2S2 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | (2,4-dichlorophenyl)methylsulfanyl-(4-hydroxyphenyl)sulfanylmethanone |
| SMILES | O=C(SCc1ccc(Cl)cc1Cl)Sc1ccc(O)cc1 |
| InChI | InChI=1S/C14H10Cl2O2S2/c15-10-2-1-9(13(16)7-10)8-19-14(18)20-12-5-3-11(17)4-6-12/h1-7,17H,8H2 |
| InChIKey | AAXLOZATFMICII-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|