C7H5Cl2O3PS-2 — CID 18922904
(2,4-dichlorophenyl)methylsulfanyl phosphite (PubChem CID 18922904) has the molecular formula C7H5Cl2O3PS-2 and a molecular weight of 271.06 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methylsulfanyl phosphite.
| Compound Name | (2,4-dichlorophenyl)methylsulfanyl phosphite |
|---|---|
| PubChem CID | 18922904 |
| Molecular Formula | C7H5Cl2O3PS-2 |
| Molecular Weight | 271.06 g/mol |
| Exact Mass | 269.91 |
| IUPAC Name | (2,4-dichlorophenyl)methylsulfanyl phosphite |
| SMILES | [O-]P([O-])OSCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H5Cl2O3PS/c8-6-2-1-5(7(9)3-6)4-14-12-13(10)11/h1-3H,4H2/q-2 |
| InChIKey | ZHEIZXINICWOAJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.06 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|